MÙA THU

Thống kê

  • truy cập   (chi tiết)
    trong hôm nay
  • lượt xem
    trong hôm nay
  • thành viên
  • Ảnh ngẫu nhiên

    Video_13cailuongEnglish.flv Uoc_mo_xanh_2.swf Be_choi_trung_thu_3.swf Tuoi_Nguyen_cam_on_11.swf Ttttttt.swf 15.jpg Con_hay_doi_roi_se_biet1.flv Ed3141000302_10200747875151946_1171193138_n__Copy.jpg R.jpg CT_GL_TH.swf Mua_he.jpg Tam_su_nang_bu_ram.swf Hoc_vien_iNET_chuc_mung_8_3_HD__YouTube.flv Chuc_mung_832013.swf Doi_canh_tinh_yeu__Hoa_tau.swf 2.swf Chuc_mung_nam_moi_tet.swf HappyNewYear_2013.swf Happynewyear.jpg Happy_New_Year_2013_no_sound1.swf

    Sắp xếp dữ liệu

    Gốc > Tham khảo hoá học 8-9 >

    Cân bằng phương trình dưới đây

    Input Equation BalancedEquation
    C3H6+O2=CO2+H2O 2C3H6 + 9O2 = 6CO2 + 6H2O
    C6H14+O2=CO2+H2O 2C6H14 + 19O2 = 12CO2 + 14H2O
    CH3NH2+O2=CO2+H2O+N2 4CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
    C6H12O6 + O2 = CO2 + H2O C6H12O6 + 6O2 = 6CO2 + 6H2O
    Ca(OH)2+H3PO4=Ca3(PO4)2+H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
    C5H12 + O2 = CO2 + H2O C5H12 + 8O2 = 5CO2 + 6H2O
    C12H24O+O2=CO2+H2O 2C12H24O + 35O2 = 24CO2 + 24H2O
    CuS + NO3- + H+ = Cu++ + S + NO + H2O 3CuS + 2NO3- + 8H+ = 3Cu++ + 3S + 2NO + 4H2O
    CuS + NO3- + H2O = Cu++ + S + NO + H2O 0CuS + 0NO3- + H2O = 0Cu++ + 0S + 0NO + H2O
    CuS + NO3--- + H2O = Cu++ + S + NO + H2O 0CuS + 0NO3--- + H2O = 0Cu++ + 0S + 0NO + H2O
    Cu + Ag+ = Cu2+ + Ag 2Cu + Ag+ = Cu2+ + Ag
    Ca +O2 = CaO 2Ca + O2 = 2CaO
    C6H12O6(aq)+C2H5OH+CO = C12H22O11 4C6H12O6(aq) + 3C2H5OH + 6CO = 3C12H22O11
    CH3NH2 + O2 = CO2 + H2O + N2 4CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
    CS2+NaOH=Na2CS3=Na2CO3+H2O 3CS2 + 6NaOH = 2Na2CS3 + Na2CO3 + 3H2O
    CH4 + O2= CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
    C3H8+O2=CO2+H2O C3H8 + 5O2 = 3CO2 + 4H2O
    CuCl2+NaOH=Cu(OH)2+NaCl CuCl2 + 2NaOH = Cu(OH)2 + 2NaCl
    Cu2S+ HNO3 = Cu(NO3)2 + CuSO4 + NO2 + H20 10Cu2S + 60HNO3 = 10Cu(NO3)2 + 10CuSO4 + 40NO2 + 3H20
    C3H8+O2=CO2+H2O C3H8 + 5O2 = 3CO2 + 4H2O
    CsOH + CO2= CsCOH+ O2 CsOH + CO2 = CsCOH + O2
    Ca(H2PO4)2 + Ca(OH)2 = Ca3(PO4)2 + H2O Ca(H2PO4)2 + 2Ca(OH)2 = Ca3(PO4)2 + 4H2O
    CH3COOH+H2O = CH3COOH CH3COOH + 0H2O = CH3COOH
    Cu(NO3)2+KI=CuI2+KNO3 Cu(NO3)2 + 2KI = CuI2 + 2KNO3
    C5H6O+O2=CO2+H2O C5H6O + 6O2 = 5CO2 + 3H2O
    C5H6O+O2=CO2+H2O C5H6O + 6O2 = 5CO2 + 3H2O
    Cu(NO3)2+ NaOH = NaNO3 + Cu(OH)2 Cu(NO3)2 + 2NaOH = 2NaNO3 + Cu(OH)2
    C3H6+O2=CO2+H2O 2C3H6 + 9O2 = 6CO2 + 6H2O
    CH4+Cl2=CCl4+HCl CH4 + 4Cl2 = CCl4 + 4HCl
    CO+O2=CO2 2CO + O2 = 2CO2
    C5H6O + O2 = CO2 + H2O C5H6O + 6O2 = 5CO2 + 3H2O
    CS2 + O2 =SO2 + CO2 CS2 + 3O2 = 2SO2 + CO2
    CO+H2 = H2O + CH4 CO + 3H2 = H2O + CH4
    Cu + HNO3 = Cu(NO3)2 + NO + H2O 3Cu + 8HNO3 = 3Cu(NO3)2 + 2NO + 4H2O
    Cu+HNO3 = Cu(NO3)2+H2O+NO 2 Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
    CO + O2 = CO2 2CO + O2 = 2CO2
    Cl2+NaOH=NaCl+NaClO3+H2O 3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
    C2H6 + O2 =CO2 + H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
    Cr(OH)3 + OH = CrO4 + H2O Cr(OH)3 + 5OH = CrO4 + 4H2O
    Cr(OH)3 + OH = CrO42 + H2O Cr(OH)3 + 81OH = CrO42 + 42H2O
    Co(NO3)2 + NH3 + H2O = NH4NO3 + Co(OH)2 Co(NO3)2 + 2NH3 + 2H2O = 2NH4NO3 + Co(OH)2
    Cu(NO3)2+KI=CuI+I2+KNO3 2Cu(NO3)2 + 4KI = 2CuI + I2 + 4KNO3
    Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
    CO2 + KOH =K2CO3 + H2O CO2 + 2KOH = K2CO3 + H2O
    CaSiO3+HF=SiF4+CaF2+H2O CaSiO3 + 6HF = SiF4 + CaF2 + 3H2O
    Cu(NO3)2+KOH=Cu(OH)2+KNO3 Cu(NO3)2 + 2KOH = Cu(OH)2 + 2KNO3
    CH3OH+O2(g) =CO2 (g) + H2O 2CH3OH + 3O2(g) = 2CO2(g) + 4H2O
    C6H6 (l)+ O2(g) =CO2 (g) + H2O 2C6H6(l) + 15O2(g) = 12CO2(g) + 6H2O
    CuSO4+ZN=Cu+ZNSO4 CuSO4 + ZN = Cu + ZNSO4
    CuO+H2SO4=CuSO4+H2O CuO + H2SO4 = CuSO4 + H2O
    CuSO4+NH3=Cu(NH3)4SO4 CuSO4 + 4NH3 = Cu(NH3)4SO4
    Cu(NO3)2+NaOH=Cu(OH)2+NaNO3 Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
    Cu+HNO3=Cu(NO3)2+NO2+H2O Cu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
    C7H5(NO2)3=C+CO+N2+H2O 2C7H5(NO2)3 = 7C + 7CO + 3N2 + 5H2O
    Cu(OH)2=CuO+H2O Cu(OH)2 = CuO + H2O
    CH3COOH + CU(OH)2 = CU(CH3COO)2 + H2O 2CH3COOH + CU(OH)2 = CU(CH3COO)2 + 2H2O
    CrCl3 + 3C2H4(NH2)2 = 3C2H4(NH2)2CrCl3 CrCl3 + C2H4(NH2)2 = C2H4(NH2)2CrCl3
    CrCl3 + C2H4(NH2)2 = 3C2H4(NH2)2CrCl3 CrCl3 + C2H4(NH2)2 = C2H4(NH2)2CrCl3
    Cu2O (s) + O2 (g) = CuO (s) 2Cu2O(s) + O2(g) = 4CuO(s)
    Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
    C5H6O+O2=CO2+H2O C5H6O + 6O2 = 5CO2 + 3H2O
    C3H6+O2=CO2+H20 10C3H6 + 30O2 = 30CO2 + 3H20
    Ca(OH)2+NH4Cl=NH3+CaCl2+H2O Ca(OH)2 + 2NH4Cl = 2NH3 + CaCl2 + 2H2O
    Ca(OH)2+NH4Cl=NH3+CaCl2+H2O Ca(OH)2 + 2NH4Cl = 2NH3 + CaCl2 + 2H2O
    C12H22O11+O2=CO2+H20 10C12H22O11 + 65O2 = 120CO2 + 11H20
    C5H6O + O2 = CO2 + H2O C5H6O + 6O2 = 5CO2 + 3H2O
    CO+H=(CH4)+H2O CO + 6H = (CH4) + H2O
    C3H6(g) + 2O2(g) = 3CO2(g) + 4H2O(l) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(l)
    C5H6O(l) + 11O2(g)= 12CO2(g) + 13H2O(l) C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(l)
    CO+H=CH3OH CO + 4H = CH3OH
    CH3NH2(g) + 24O2(g)= 25CO2(g) + 26H2O(g) + 27N2(g) 4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
    CO+H=CH3OH CO + 4H = CH3OH
    C5H10O2+O2=CO2+H2O 2C5H10O2 + 13O2 = 10CO2 + 10H2O
    CH4+Cl2=CCl4+HCl CH4 + 4Cl2 = CCl4 + 4HCl
    CaC2(s)+H2O(l)=Ca(OH)2(s)+C2H2(g) CaC2(s) + 2H2O(l) = Ca(OH)2(s) + C2H2(g)
    C4H8O2N2+Pd=Pd(C4H7N2O2)2+H 2C4H8O2N2 + Pd = Pd(C4H7N2O2)2 + 2H
    CaC2(s)+H2O(l)=Ca(OH)2(s)C2H2(g) CaC2(s) + 2H2O(l) = Ca(OH)2(s)C2H2(g)
    CO+O2=CO2 2CO + O2 = 2CO2
    C3H5(NO3)3=CO2+N2+H2O+O2 4C3H5(NO3)3 = 12CO2 + 6N2 + 10H2O + O2
    Ca3(PO4)2+SiO2+C=CaSiO3+P4+CO 2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO
    CH3CH2CH3 + O2 = CO2+H2O CH3CH2CH3 + 5O2 = 3CO2 + 4H2O
    C6H14 + O2 = CO2 + H20 10C6H14 + 60O2 = 60CO2 + 7H20
    CH3CH3 + O2 = CO2+H2O 2CH3CH3 + 7O2 = 4CO2 + 6H2O
    Cl2+NaOH= NaCl + NaClO3 +H20 30Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
    CH4 + Br2 = CBr4 + HBr CH4 + 4Br2 = CBr4 + 4HBr
    Cl2+NaOH= NaCl + NaClO3 +H20 30Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
    Ca(NO3)2+(NH4)2(HPO4)+NH3+H2O = Ca10(PO4)6(OH)2+NH4NO3 10Ca(NO3)2 + 6(NH4)2(HPO4) + 8NH3 + 2H2O = Ca10(PO4)6(OH)2 + 20NH4NO3
    C + Fe2O3 = Fe + CO2 3C + 2Fe2O3 = 4Fe + 3CO2
    Cl2+NaOH= NaCl + Na ClO3 +H20 30Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
    C3H6(g) + O2(g)= CO2(g) + H2O(g) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(g)
    C2H6+O2=CO2+H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
    Cd(NO3)2+Na2S=CdS+NaNO3 Cd(NO3)2 + Na2S = CdS + 2NaNO3
    C + Fe2O3 = Fe + CO 3C + Fe2O3 = 2Fe + 3CO
    Cu(NO3)2+KI=CuI+I2+KNO3 2Cu(NO3)2 + 4KI = 2CuI + I2 + 4KNO3
    C7H16+O2=CO2+H2O C7H16 + 11O2 = 7CO2 + 8H2O
    C7H16+O2=CO2+H2O C7H16 + 11O2 = 7CO2 + 8H2O
    C2H6 +O2 = CO2 + H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
    Cl2+NaOH = NaCl + NaClO3 + H2O 3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
    Co2O3+C=Co+CO2 2Co2O3 + 3C = 4Co + 3CO2
    C6H6+O2=CO+H2O 2C6H6 + 9O2 = 12CO + 6H2O
    C12H22O11+O2=CO2+H20 10C12H22O11 + 65O2 = 120CO2 + 11H20
    CuNO3*3H2O = CuO+NO2+O2+H2O CuNO3*3H2O = CuO + NO2 + 0O2 + 3H2O
    Cl2 + NaI = NaCl + I2 Cl2 + 2NaI = 2NaCl + I2
    C3H8 + 2O2 = 3CO2 + 4H2O C3H8 + 5O2 = 3CO2 + 4H2O
    C9H6O4+O2=CO2+H2O 2C9H6O4 + 17O2 = 18CO2 + 6H2O
    Cl2+NaOH=NaCl+NaClO3+H20 30Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
    C5H6O(l)+O2(g)=CO2(g)+H2O C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O
    CO2 + 6H2 = CH4 + 4H2O CO2 + 4H2 = CH4 + 2H2O
    Ca(NO3)2 + (NH4)2HPO4 + NH3 + H2O = Ca10(PO4)6(OH)2 + NH4NO3 10Ca(NO3)2 + 6(NH4)2HPO4 + 8NH3 + 2H2O = Ca10(PO4)6(OH)2 + 20NH4NO3
    Cl2+NaOH=NaCl+NaClO3+6H20 30Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
    CS2(s)+O2=2S+CO2 CS2(s) + O2 = 2S + CO2
    Cu+CuSO4=CuSO4 0Cu + CuSO4 = CuSO4
    CaSiO3(s)+HF(aq)=CaF2(aq)+SiF4(g)+H2O(l) CaSiO3(s) + 6HF(aq) = CaF2(aq) + SiF4(g) + 3H2O(l)
    CS2(s)+O2=CS+CO2 -1CS2(s) + O2 = -2CS + CO2
    Cu+AgNO3=CuNO3+Ag Cu + AgNO3 = CuNO3 + Ag
    CS2(s)+O2=CO2+CS CS2(s) - O2 = -1CO2 + 2CS
    CS2(s)+O2=CO2+CS CS2(s) - O2 = -1CO2 + 2CS
    C5H6O+O2=CO2+H2O C5H6O + 6O2 = 5CO2 + 3H2O
    CaCl2 + Ag(NO3) = Ca(NO3)2 + AgCl CaCl2 + 2Ag(NO3) = Ca(NO3)2 + 2AgCl
    Cl2+NaOH=NaCl+NaClO3+H20 30Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
    CH3NH2 (g) + O2(g)=CO2(g) + H2 O(g) + N2 (g ) 4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
    C4H6(g)+O2(g)=H2O+CO2 2C4H6(g) + 11O2(g) = 6H2O + 8CO2
    C3H6+O2=CO2+H2O 2C3H6 + 9O2 = 6CO2 + 6H2O
    CaCl2 + Ag(NO3) = Ca(NO3)2 + AgCl CaCl2 + 2Ag(NO3) = Ca(NO3)2 + 2AgCl
    Ca(OH)2(aq) + H3PO4(aq)=Ca3(PO4)2(s) + H2O( l ) 3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2(s) + 6H2O(l)
    C4H10O + O2 = CO2 + H2O C4H10O + 6O2 = 4CO2 + 5H2O
    Ca(H2PO4)2 (s) + NaHCO3 (s) = CO2 (g) + H2O (g) + CaHPO4 (s) + Na2HPO4 (s) Ca(H2PO4)2(s) + 2NaHCO3(s) = 2CO2(g) + 2H2O(g) + CaHPO4(s) + Na2HPO4(s)
    Ca3P2( s ) + H2O( l )=Ca(OH)2(aq) + PH3( g ) Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
    C2H5OH + O2 = CO2 + H2O C2H5OH + 3O2 = 2CO2 + 3H2O
    CaO + HNO3 = Ca(NO3)2 + H2O CaO + 2HNO3 = Ca(NO3)2 + H2O
    CaO + HNO3 = Ca(NO3)2 + H2O CaO + 2HNO3 = Ca(NO3)2 + H2O
    Ca(s) + H2O(l) =Ca(OH)2 (s) + H2 (g) Ca(s) + 2H2O(l) = Ca(OH)2(s) + H2(g)
    CO2 + H2O = C6H12O6 + O2 6CO2 + 6H2O = C6H12O6 + 6O2
    C18H36O2 + O2 = CO2 + H2O C18H36O2 + 26O2 = 18CO2 + 18H2O
    C2H5OH + C3H7OH = CO2 + H2O 3C2H5OH - 2C3H7OH = 0CO2 + H2O
    C2H5OH + CH3OH = CO2 + H2O -1C2H5OH + 2CH3OH = 0CO2 + H2O
    C5H12 + O2 = CO2 + H2O C5H12 + 8O2 = 5CO2 + 6H2O
    CH3(CH2)2CH3 + O2 = CO2 + H2O 2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
    C8H18 + O2 = CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
    C3H8 + O2 = CO2 + H2O C3H8 + 5O2 = 3CO2 + 4H2O
    C3H18 + O2 = CO2 + H2O 2C3H18 + 15O2 = 6CO2 + 18H2O
    CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
    Cu(NO3)2(aq)+MgSO4(aq)=Mg(NO3)2(s)+CuSO4(aq) Cu(NO3)2(aq) + MgSO4(aq) = Mg(NO3)2(s) + CuSO4(aq)
    CO(g)+O2(g)=CO2(g) 2CO(g) + O2(g) = 2CO2(g)
    C4 H10 O + O2 = CO2 + H2O C4H10O + 6O2 = 4CO2 + 5H2O
    C10H16+Cl2=C+HCl C10H16 + 8Cl2 = 10C + 16HCl
    C6H5COOH + O2 = CO2 + H2O 2C6H5COOH + 15O2 = 14CO2 + 6H2O
    Cl2+H2O=HCl+HClO3 3Cl2 + 3H2O = 5HCl + HClO3
    CaCO3 = CaO + CO2 CaCO3 = CaO + CO2
    CaCO3 + HCl = CaCl2 + CO2 + H2O CaCO3 + 2HCl = CaCl2 + CO2 + H2O
    CO2+KOH=K2CO3+H2O CO2 + 2KOH = K2CO3 + H2O
    C2H4+O2=CO2+H2O C2H4 + 3O2 = 2CO2 + 2H2O
    C6H6 + O2 = CO + H2O 2C6H6 + 9O2 = 12CO + 6H2O
    CO(g)+O2(g)=CO2(g) 2CO(g) + O2(g) = 2CO2(g)
    CaCO3 + H2O= Ca(OH)2 + CO2 CaCO3 + H2O = Ca(OH)2 + CO2
    Ca(NO3)2(s) + (NH4)2HPO4(s) + NH3(aq) + H2O(l) = Ca10(PO4)6(OH)2(s) + NH4NO3(aq) 10Ca(NO3)2(s) + 6(NH4)2HPO4(s) + 8NH3(aq) + 2H2O(l) = Ca10(PO4)6(OH)2(s) + 20NH4NO3(aq)
    C2H6+O2=CO2+H20 10C2H6 + 20O2 = 20CO2 + 3H20
    CuSO4 + NH3 = CuH3+NSO4 CuSO4 + NH3 = CuH3 + NSO4
    Ca(NO3)2(s) + (NH4)HPO4(s) + NH3(aq) + H2O(l) = Ca10(PO4)6(OH)2(s) + NH4NO3(aq) 40Ca(NO3)2(s) + 24(NH4)HPO4(s) + 62NH3(aq) + 17H2O(l) = 4Ca10(PO4)6(OH)2(s) + 83NH4NO3(aq)
    Ca(NO3)2(s) + (NH4)HPO4(s) + NH3(aq) + H2O(l) = Ca10(PO4)(OH)2(s) + NH4NO3(aq) 10Ca(NO3)2(s) + (NH4)HPO4(s) + 23NH3(aq) + 8H2O(l) = Ca10(PO4)(OH)2(s) + 22NH4NO3(aq)
    Cu(NO3)2 + KI = CuI + I2 + 3KNO3 2Cu(NO3)2 + 4KI = 2CuI + I2 + 4KNO3
    Cl2+NaOH=NaCl+NaClO3+H2O 3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
    C2H4+O2=CO2+H2O C2H4 + 3O2 = 2CO2 + 2H2O
    C2H4+O2=C+H2O C2H4 + O2 = 2C + 2H2O
    C2H4(g) + O2(g) = CO2(g) + H2O(g) C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(g)
    C2H4(g) + O2(g) = CO(g) + H2O(g) C2H4(g) + 2O2(g) = 2CO(g) + 2H2O(g)
    CO+O2=CO2 2CO + O2 = 2CO2
    C2H4(g) + O2(g) = CO(s) + H2O(g) C2H4(g) + 2O2(g) = 2CO(s) + 2H2O(g)
    C4H9NH2 + O2 = CO2 + H2O + N2 4C4H9NH2 + 27O2 = 16CO2 + 22H2O + 2N2
    Cl2+NaOH= NaCl+NaClO3+H2O 3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
    CO+H=CH4+H2O CO + 6H = CH4 + H2O
    C2H4(g) + O2(g) = C(s) + H2O(g) C2H4(g) + O2(g) = 2C(s) + 2H2O(g)
    C2H6 + O2 = CO2 + H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
    Cl2(g)+NaOH(aq)=NaCl(aq)+NaClO3(aq)+H2O(l) 3Cl2(g) + 6NaOH(aq) = 5NaCl(aq) + NaClO3(aq) + 3H2O(l)
    ClO + Fe(OH)3 = Cl + FeO4 + H2 2ClO + 2Fe(OH)3 = 2Cl + 2FeO4 + 3H2
    ClO + Fe(OH)3 = Cl + FeO4 + H ClO + Fe(OH)3 = Cl + FeO4 + 3H
    ClO + Fe(OH)3 = Cl + FeO4 + H ClO + Fe(OH)3 = Cl + FeO4 + 3H
    Cr2O7 + C2H4O = C2H4O2 + Cr Cr2O7 + 7C2H4O = 7C2H4O2 + 2Cr
    C6H12O6 + 3O2 = 3CO2 + 3H2O C6H12O6 + 6O2 = 6CO2 + 6H2O
    CaCO3=CaO+CO2 CaCO3 = CaO + CO2
    CH3OH + O2= CO2+ H2O 2CH3OH + 3O2 = 2CO2 + 4H2O
    Cl2+NaOH=NaCl+NaClO3+H2O 3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
    CaCO3 + H3O = H2O + CO2 + Ca CaCO3 + 2H3O = 3H2O + CO2 + Ca
    CS2 + NaOH = Na2CS3 + Na2CO3 + H2O 3CS2 + 6NaOH = 2Na2CS3 + Na2CO3 + 3H2O
    CO+O2=CO2 2CO + O2 = 2CO2
    C+O2=CO 2C + O2 = 2CO
    CaCO3 + HCl = CaCl2 + H2O + CO2 CaCO3 + 2HCl = CaCl2 + H2O + CO2
    C4H10 + O2 = CO2 + H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
    Cu + HNO3 = Cu(NO3)2 + NO2 + H2O Cu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
    CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
    CuO+2HBr=CuBr2+H2O CuO + 2HBr = CuBr2 + H2O
    C4H10O+O2=CO2+H2O C4H10O + 6O2 = 4CO2 + 5H2O
    CH4 + Br2 = CBr4 + HBr CH4 + 4Br2 = CBr4 + 4HBr
    Cl2+NaOH=NaCl+NaClO3+H20 30Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
    CH3CSNH2 + H2O = SH2 + CH3CONH2 CH3CSNH2 + H2O = SH2 + CH3CONH2
    Ca2 + H2O = CaO + H2 Ca2 + 2H2O = 2CaO + 2H2
    Cu+HNO3=Cu(NO3)2+H2 Cu + 2HNO3 = Cu(NO3)2 + H2
    CH4=C3H8+H2 3CH4 = C3H8 + 2H2
    Cl + H2O2 = HCl +H2O -2Cl + H2O2 = -2HCl + 2H2O
    Cl + H2O = HCl +H2O 0Cl + H2O = 0HCl + H2O
    C6H12O6+O2=CO2+ H2O C6H12O6 + 6O2 = 6CO2 + 6H2O
    Ca+I2=CaI 2Ca + I2 = 2CaI
    C2H8N2 + N2O4 = N2 + CO2 + H2O C2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
    C10H22+O2=CO2+H2O 2C10H22 + 31O2 = 20CO2 + 22H2O
    C9H20+O2=CO2+H2O C9H20 + 14O2 = 9CO2 + 10H2O
    C8H18+O2=CO2+H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
    C7H16+O2=CO2+H2O C7H16 + 11O2 = 7CO2 + 8H2O
    C6H14+O2=CO2+H2O 2C6H14 + 19O2 = 12CO2 + 14H2O
    C5H12+O2=CO2+H2O C5H12 + 8O2 = 5CO2 + 6H2O
    CH4 +H2S =CS2 +H2 CH4 + 2H2S = CS2 + 4H2
    C4H10+O2=CO2+H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
    C2H6+O2=CO2+H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
    Cu(OH)2= CuO + H2O Cu(OH)2 = CuO + H2O
    CaCl2 + AgNO3 = CaNO3 + AgCl2 CaCl2 + AgNO3 = CaNO3 + AgCl2
    CH4+O2=CO2+H2O CH4 + 2O2 = CO2 + 2H2O
    CaCl2 + Mg(NO3)2 = Ca(NO3)2 + MgCl2 CaCl2 + Mg(NO3)2 = Ca(NO3)2 + MgCl2
    Cu(NO3)2 + 2NaOH=Cu(OH)2 + 2NaNO3 Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
    C3H8+O2=CO2+H2O C3H8 + 5O2 = 3CO2 + 4H2O
    Cu+4 HNO3=Cu(NO3)2+2 H2O+2 NO2 Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
    CaCO3 = CaO + CO2 CaCO3 = CaO + CO2
    CaCO3 = CaO + CO2 CaCO3 = CaO + CO2
    CaCO3 = CaO +CO2 CaCO3 = CaO + CO2
    Cu(OH)2 = CuO + H2O Cu(OH)2 = CuO + H2O
    C5H12+8O2=5CO2=6H2O C5H12 + 8O2 = 5CO2 + 6H2O
    C3H6 + Br2= C3H6Br2 C3H6 + Br2 = C3H6Br2
    Cu + H2SO4 = H2O + CuSO4 + H2 Cu + H2SO4 = 0H2O + CuSO4 + H2
    CH4 + O2 = CO + H2O 2CH4 + 3O2 = 2CO + 4H2O
    Cl + H2O = H3OCl + HClO3 6Cl + 8H2O = 5H3OCl + HClO3
    C8H18 + O2 = CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
    C4H8 + O2 = CO2 + H2O C4H8 + 6O2 = 4CO2 + 4H2O
    Cu + HNO3 = Cu(NO3)2 + H2O + 4NO 3Cu + 8HNO3 = 3Cu(NO3)2 + 4H2O + 2NO
    Ca + HCl = CaCl + H Ca + HCl = CaCl + H
    Ca2 + HCl = CaCl2 + H2 Ca2 + 4HCl = 2CaCl2 + 2H2
    C5H6O(l) + O2(g) = CO2(g) + H2O(l) C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(l)
    C3H6(g) + O2(g) = CO2(g) + H2O(l) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(l)
    Ca(HCO3)2 = CaCO3 + H2O + CO2 Ca(HCO3)2 = CaCO3 + H2O + CO2
    Cu + Cl2 = CuCl2 Cu + Cl2 = CuCl2
    Cl2 + 2NaI = 2NaCl + 2I Cl2 + 2NaI = 2NaCl + 2I
    Cl2+NaOH = NaCl+NaClO3+H2O 3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
    Ca(NO3)2 = CaO + NO2 + O2 2Ca(NO3)2 = 2CaO + 4NO2 + O2
    Ca(OH)2 + H3PO4= Ca3(PO4)2 + H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
    C2H6O (l) + O2(g) = CO2(g) + H2O(l) C2H6O(l) + 3O2(g) = 2CO2(g) + 3H2O(l)
    CaCl2+NaF=NaCl2+Ca+F CaCl2 + NaF = NaCl2 + Ca + F
    Ca2 + HCl = CaCl2 + H Ca2 + 4HCl = 2CaCl2 + 4H
    Ca2 + HCl = CaCl2 + H2 Ca2 + 4HCl = 2CaCl2 + 2H2
    Cu + H2SO4 = CuSO4 + SO2 + H2O Cu + 2H2SO4 = CuSO4 + SO2 + 2H2O
    CaCl2+NaF=NaCl2+CaF CaCl2 + NaF = NaCl2 + CaF
    CaCl2+NaF=NaCl2+CaF CaCl2 + NaF = NaCl2 + CaF
    CaCl2+NaF=NaCl2+CaF CaCl2 + NaF = NaCl2 + CaF
    C+O2=CO 2C + O2 = 2CO
    CaSO4+K2CO3=CaCO3+K2SO4 CaSO4 + K2CO3 = CaCO3 + K2SO4
    C2H6+Cl2=C2H5Cl+C2H4Cl2 -1C2H6 + 0Cl2 = -2C2H5Cl + C2H4Cl2
    C2H5OH + O2 = CO2 + H2O C2H5OH + 3O2 = 2CO2 + 3H2O
    Ca + HCl = CaCl + H Ca + HCl = CaCl + H
    Cl2 + NaI = NaCl + I2 Cl2 + 2NaI = 2NaCl + I2
    Cu2CO3(OH)2=CuO+CO2+2H2O Cu2CO3(OH)2 = 2CuO + CO2 + H2O
    CaO(s) + CO2(g) = CaCO3(s) CaO(s) + CO2(g) = CaCO3(s)
    C3H6O2(l) +O2(g)= CO2(g) + H2O 2C3H6O2(l) + 7O2(g) = 6CO2(g) + 6H2O
    CaSiO3 + HF = SiF4 + CaF2 + H2O CaSiO3 + 6HF = SiF4 + CaF2 + 3H2O
    CaSiO3 + HF = SiF4 + CaF2 + H2O CaSiO3 + 6HF = SiF4 + CaF2 + 3H2O
    Cu(NO3)2 + KOH = Cu(OH)2 + KNO3 Cu(NO3)2 + 2KOH = Cu(OH)2 + 2KNO3
    Cu + HNO3 = Cu(NO3)2 + NO2 + H2O Cu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
    C4H10 + O2 = CO2 + H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
    CH3COONa + H2O = CH3COO + Na CH3COONa + 0H2O = CH3COO + Na
    CA CO3 + HC1 = CAC1 + CO2 + H2O 5CACO3 + 6HC1 = 5CAC1 + 6CO2 + 3H2O
    CACO3 + HC1 = CAC1 + CO2 + H2O 5CACO3 + 6HC1 = 5CAC1 + 6CO2 + 3H2O
    CO2 + H2O = C6H12O6 + O2 6CO2 + 6H2O = C6H12O6 + 6O2
    C8H18+O4=C3O6+H8O4 12C8H18 + 75O4 = 32C3O6 + 27H8O4
    Cl2+NaOH=NaCl+NaClO3+H20 30Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
    Cl2+NaOH=NaCl+NaClO3+H20 30Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
    C2H6 + O2 = H2O + CO2 2C2H6 + 7O2 = 6H2O + 4CO2
    C3H8 + O2 = CO2 + H2O C3H8 + 5O2 = 3CO2 + 4H2O
    CH4 + Br2 = CBr4 +HBr CH4 + 4Br2 = CBr4 + 4HBr
    CS2+NaOH=Na2CS3+Na2CO3+H2O 3CS2 + 6NaOH = 2Na2CS3 + Na2CO3 + 3H2O
    Cu2O2(s)+C(s)=Cu(s)+CO(g) Cu2O2(s) + 2C(s) = 2Cu(s) + 2CO(g)
    C2H8N2 + N2O4 = N2 + CO2 + H2O C2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
    CaCl2(aq)+Na2CO3(H2O)(aq)=CaCO3+NaCl+H2O CaCl2(aq) + Na2CO3(H2O)(aq) = CaCO3 + 2NaCl + H2O
    C2H6O + O2 = C2H4O2 + H2O C2H6O + O2 = C2H4O2 + H2O
    CH4 + O3 = CO2 + H2O 3CH4 + 4O3 = 3CO2 + 6H2O
    Cu + HNO3 = Cu (NO3)2 + NO2 + H2O Cu + 4HNO3 = Cu(NO3)2 + 2NO2 + 2H2O
    Cu(s) + H2SO4(aq) = CuSO4(aq) + H2(g) Cu(s) + H2SO4(aq) = CuSO4(aq) + H2(g)
    C+ HNO3 = CO2 + NO2 + H2O C + 4HNO3 = CO2 + 4NO2 + 2H2O
    C+S=CS2 C + 2S = CS2
    C6H12O + K2Cr2O7 = C6H10O + H2O + KCr 7C6H12O + K2Cr2O7 = 7C6H10O + 7H2O + 2KCr
    Cu+H2SO4=Cu(SO4)2+SO2+H2O Cu + 4H2SO4 = Cu(SO4)2 + 2SO2 + 4H2O
    C3H6(g) + O2(g) = CO2(g) + H2O(l) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(l)
    C2H4(g) + 2O2(g) = 2CO2(g) + 2H2O(l) C2H4(g) + 3O2(g) = 2CO2(g) + 2H2O(l)
    C6H14 + O2 = H2O + CO2 2C6H14 + 19O2 = 14H2O + 12CO2
    Cu(NO3)2+Na2CO3=CuCO3+NaNO3 Cu(NO3)2 + Na2CO3 = CuCO3 + 2NaNO3
    CuSO4+KI=CuI+KSO4 CuSO4 + KI = CuI + KSO4
    CaCO3 = CaO + CO2 CaCO3 = CaO + CO2
    Cu+AgNO3 = Cu(NO3)2 + Ag Cu + 2AgNO3 = Cu(NO3)2 + 2Ag
    C8H18 + O2 = CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
    C2H5OH + O2 = H2O + CO2 C2H5OH + 3O2 = 3H2O + 2CO2
    Co(NO3)3+(NH4)2S = Co2S3+NH4NO3 2Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
    CaCl2+Na3PO4=Ca3(PO4)2+NaCl 3CaCl2 + 2Na3PO4 = Ca3(PO4)2 + 6NaCl
    C2H8N2+N2O4=N2+CO2+H2O C2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
    C2H8N2 + N2O4 = N2 + CO2 + H2O C2H8N2 + 2N2O4 = 3N2 + 2CO2 + 4H2O
    C2H6O + O2 = C2H4O2 + H2O C2H6O + O2 = C2H4O2 + H2O
    Cu2O (s) + O2 (g) = CuO (s) 2Cu2O(s) + O2(g) = 4CuO(s)
    Cu(NO3)2 + Na2CO3 = CuCO3 + (NO3)2Na2 Cu(NO3)2 + Na2CO3 = CuCO3 + (NO3)2Na2
    C2H6O + O2 = C2H4O2 + H2O C2H6O + O2 = C2H4O2 + H2O
    C + HNO3 = CO2 + NO2 + H2O C + 4HNO3 = CO2 + 4NO2 + 2H2O
    CU + HNO3 = CU( NO3)2 + NO2 + H2O CU + 4HNO3 = CU(NO3)2 + 2NO2 + 2H2O
    Cl2+NaOH=NaCl+NaClO3+H2O 3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
    C6H14 + O2 = CO2 + H2O 2C6H14 + 19O2 = 12CO2 + 14H2O
    C+H+O=CHO C + H + O = CHO
    Ca+O2=CaO 2Ca + O2 = 2CaO
    CaCO3 + HCl = CaCl2 + CO2 + H2O CaCO3 + 2HCl = CaCl2 + CO2 + H2O
    CuSO4 + KI = CuI + KSO4 CuSO4 + KI = CuI + KSO4
    Ca(NO3)2 = CaO + NO2 + O2 2Ca(NO3)2 = 2CaO + 4NO2 + O2
    Ca3(PO4)2 + SiO2 + C = P4 + CO + CaSiO3 2Ca3(PO4)2 + 6SiO2 + 10C = P4 + 10CO + 6CaSiO3
    CH3COOH + Mg = H2 + MgCH3COO 2CH3COOH + 2Mg = H2 + 2MgCH3COO
    C4H10+O2=CO2+H20 2C4H10 + 8O2 = 8CO2 + H20
    CH3COOH + Mg++ = H+2 + CH3COO- + Mg++ 0CH3COOH + Mg++ = 0H+2 + 0CH3COO- + Mg++
    C2H6 + O2 = H2O + CO2 2C2H6 + 7O2 = 6H2O + 4CO2
    C2H6 + O2 = H2O +CO2 2C2H6 + 7O2 = 6H2O + 4CO2
    C5H60+O2=CO2+H2O C5H60 + 20O2 = 5CO2 + 30H2O
    C2H2+O2=CO2+H2O 2C2H2 + 5O2 = 4CO2 + 2H2O
    Ca(OH)2 + HNO3 = Ca(NO3)2 +H2O Ca(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
    Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g) Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g)
    Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g) Ca(s) + 2H2O(l) = Ca(OH)2(aq) + H2(g)
    Cu(OH)2 + HNO3 = Cu(NO3)2 + H2O Cu(OH)2 + 2HNO3 = Cu(NO3)2 + 2H2O
    C2H6O+O2=CO2+H20 10C2H6O + 15O2 = 20CO2 + 3H20
    C12H22O11+O2=CO2+H2O C12H22O11 + 12O2 = 12CO2 + 11H2O
    C8H18 + O2=CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
    C5H12 + F2 = CF4 + HF C5H12 + 16F2 = 5CF4 + 12HF
    CaCO3 = CaO + CO2 CaCO3 = CaO + CO2
    C12H26+O2=CO2+H2O 2C12H26 + 37O2 = 24CO2 + 26H2O
    CaCN2 + H2O = CaCO3 + NH3 CaCN2 + 3H2O = CaCO3 + 2NH3
    Ca3(PO4)2 + SiO2 +C = CaSiO3 + CO + P4 2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + 10CO + P4
    C + O + N + H = H2NCH2COOH 2C + 2O + N + 5H = H2NCH2COOH
    CS2 + NH3 = H2S + NH4SCN CS2 + 2NH3 = H2S + NH4SCN
    C2H6 + O2 = CO2 + H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
    C3H6 + O2 = CO2 + H2O 2C3H6 + 9O2 = 6CO2 + 6H2O
    C3H8O+HClO4=CO2+H2O+HCl 4C3H8O + 9HClO4 = 12CO2 + 16H2O + 9HCl
    C4H10 + O2 = CO2 + H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
    CuOH+ KSO4 = KOH +CuSO4 CuOH + KSO4 = KOH + CuSO4
    CuOH KSO4 = KOH CuSO4 CuOHKSO4 = KOHCuSO4
    Ca(OH)2 + HNO3 = Ca(NO3)2 + H2O Ca(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
    CuSO4+Fe=FeSO4 + Cu CuSO4 + Fe = FeSO4 + Cu
    Cl5+Hg8=Cl28Hg3 224Cl5 + 15Hg8 = 40Cl28Hg3
    C8H18+O2 = CO2+H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
    CaCl2(aq) + (NH4)2CO3(aq) = CaCO3(s) + NH4Cl(aq) CaCl2(aq) + (NH4)2CO3(aq) = CaCO3(s) + 2NH4Cl(aq)
    CuO + C = Cu + CO2 2CuO + C = 2Cu + CO2
    Ca(OH)2(aq)+H3PO4(aq)=Ca3(PO4)2(s)+H2O(l) 3Ca(OH)2(aq) + 2H3PO4(aq) = Ca3(PO4)2(s) + 6H2O(l)
    Ca3P2(s)+H2O(l)=Ca(OH)2(aq)+PH3(g) Ca3P2(s) + 6H2O(l) = 3Ca(OH)2(aq) + 2PH3(g)
    CuO + H2SO4 = CuSO4+H2O CuO + H2SO4 = CuSO4 + H2O
    CH3NH2(g)+O2(g)=CO2(g)+H2O(g)+N2(g) 4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
    Cl2(g) + 2 OH- (aq) = Cl-(aq) + OCl-(aq) + H2O(l) Cl2(g) + 2OH-(aq) = Cl-(aq) + OCl-(aq) + H2O(l)
    Cu + HNO3 = Cu(NO3)2 + NO2 + H20 10Cu + 20HNO3 = 10Cu(NO3)2 + 0NO2 + H20
    Ca(OH)2(aq)+H3PO4=Ca3(PO4)2(s)+H2O(l) 3Ca(OH)2(aq) + 2H3PO4 = Ca3(PO4)2(s) + 6H2O(l)
    C2H4(g) + O2(g) = CO(g) + H2O(g) C2H4(g) + 2O2(g) = 2CO(g) + 2H2O(g)
    C5H10O2 + O2 = CO2 + H2O 2C5H10O2 + 13O2 = 10CO2 + 10H2O
    CH3CH2+ O2 = H2O + CH3COOH 4CH3CH2 + 5O2 = 2H2O + 4CH3COOH
    C8H18 + O2= CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
    Cu3(PO4)2(s) + HCl(aq) = CuCl2(aq) + H3(PO4)(aq) Cu3(PO4)2(s) + 6HCl(aq) = 3CuCl2(aq) + 2H3(PO4)(aq)
    CH3(CH2)6CH3 + O2 = CO2 +H2O 2CH3(CH2)6CH3 + 25O2 = 16CO2 + 18H2O
    CuSO4(aq) + 2Na3PO4(aq) = Cu3(PO4)2 + 3Na2SO4 3CuSO4(aq) + 2Na3PO4(aq) = Cu3(PO4)2 + 3Na2SO4
    CH3(CH2)2CH3 + O2 = CO2 +H2O 2CH3(CH2)2CH3 + 13O2 = 8CO2 + 10H2O
    C6H12O6+O2=CO2+H2O C6H12O6 + 6O2 = 6CO2 + 6H2O
    CH4+O2=CO2+H2O CH4 + 2O2 = CO2 + 2H2O
    CA3P2+H2O=CA3(PO4)2+H2O 0CA3P2 + H2O = 0CA3(PO4)2 + H2O
    CH4+Br2=CBr4+HBr CH4 + 4Br2 = CBr4 + 4HBr
    CH3(CH2)4CH3 +O2 = CO2 +H2O 2CH3(CH2)4CH3 + 19O2 = 12CO2 + 14H2O
    CH3CH3 + O2 = CO2 + H2O 2CH3CH3 + 7O2 = 4CO2 + 6H2O
    CrI3 + NaNO3 = Na2CrO4 + NaIO3 + NO + Na2O CrI3 + 7NaNO3 = Na2CrO4 + 3NaIO3 + 7NO + Na2O
    Cu(NO3)2+NH4OH=Cu(OH)2+(NH4)NO3 Cu(NO3)2 + 2NH4OH = Cu(OH)2 + 2(NH4)NO3
    CH4 + Br2 = CBr4 + HBr CH4 + 4Br2 = CBr4 + 4HBr
    CaCO3(s) + HCl(aq) =CO2(g) + CaCl2(aq) + H2O(l) CaCO3(s) + 2HCl(aq) = CO2(g) + CaCl2(aq) + H2O(l)
    Cl2 + NaOH = NaCl +NaClO3 + H20 30Cl2 + 60NaOH = 40NaCl + 20NaClO3 + 3H20
    Cu+H2SO4=Cu(SO4)2+SO2+H2O Cu + 4H2SO4 = Cu(SO4)2 + 2SO2 + 4H2O
    CuSO4+Na3PO4=CuPO4+Na3SO4 CuSO4 + Na3PO4 = CuPO4 + Na3SO4
    CuSO4+NaOH=CuOH+NaSO4 CuSO4 + NaOH = CuOH + NaSO4
    CuSO4+NaCO3=CuCO3+NaSO4 CuSO4 + NaCO3 = CuCO3 + NaSO4
    CH4 +H2O = CO + H2 CH4 + H2O = CO + 3H2
    Cl2+NaOH = NaCl+NaClO3+H2O 3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
    C12H22O11 + H2O = C2H5OH + CO2 C12H22O11 + H2O = 4C2H5OH + 4CO2
    C2H6 + O2 = CO2 + H2O 2C2H6 + 7O2 = 4CO2 + 6H2O
    CH4 + O2 = CO2 + H2O CH4 + 2O2 = CO2 + 2H2O
    Ca3(PO4)2 + H2SO4 = CaSO4 + Ca(H2PO4)2 Ca3(PO4)2 + 2H2SO4 = 2CaSO4 + Ca(H2PO4)2
    Cu+S = CuS Cu + S = CuS
    C3H8+O2=CO2+H2O C3H8 + 5O2 = 3CO2 + 4H2O
    CH3OH + O2 = CO2 +H2O 2CH3OH + 3O2 = 2CO2 + 4H2O
    C5H10O2 + O2 = CO2 + H2O 2C5H10O2 + 13O2 = 10CO2 + 10H2O
    C5H10O2+O2=CO2+H2O 2C5H10O2 + 13O2 = 10CO2 + 10H2O
    CO2+CaSiO3+H2O=SiO2+Ca(HCO3)2 2CO2 + CaSiO3 + H2O = SiO2 + Ca(HCO3)2
    Ca(HCO3)2 = CaCO3 + CO2 + H2O Ca(HCO3)2 = CaCO3 + CO2 + H2O
    Cu + HNO3 = Cu(NO3)2 + H2O + NO2 Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
    Cu + HNO3 = Cu(NO3)2 + H2O + NO2 Cu + 4HNO3 = Cu(NO3)2 + 2H2O + 2NO2
    CuSO4+NaOH=CuNa+SO4+OH CuSO4 + NaOH = CuNa + SO4 + OH
    C9H20+ O2 =H2O +CO2 C9H20 + 14O2 = 10H2O + 9CO2
    CH3OH(g) + O2(g) =CO2(g) + H2O(g) 2CH3OH(g) + 3O2(g) = 2CO2(g) + 4H2O(g)
    Ca(HCO3)2 = CaCO3 + CO2 + H2O Ca(HCO3)2 = CaCO3 + CO2 + H2O
    Ca(HCO3)2 =CaCO3 + CO2 + H2O Ca(HCO3)2 = CaCO3 + CO2 + H2O
    C8H18+ O = CO2 + H2O C8H18 + 25O = 8CO2 + 9H2O
    Ca(HCO3)2 = CaCO3 + CO2 + H2O Ca(HCO3)2 = CaCO3 + CO2 + H2O
    Ca(HCO3)2 = CaCO3 + CO2 + H2O Ca(HCO3)2 = CaCO3 + CO2 + H2O
    C4H10+O2=CO2+H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
    CH3(CH2)6CH3 + O = CO2 + H2O CH3(CH2)6CH3 + 25O = 8CO2 + 9H2O
    Cu + S = Cu2S 2Cu + S = Cu2S
    Cu + S = CuS Cu + S = CuS
    C5H6O+O2=CO2+H2O C5H6O + 6O2 = 5CO2 + 3H2O
    C3H6+O2=CO2+H2O 2C3H6 + 9O2 = 6CO2 + 6H2O
    CH3OH + O2 = CO2 + H2O 2CH3OH + 3O2 = 2CO2 + 4H2O
    Co(NO3)3 + (NH4)2S = Co2S3 + NH4NO3 2Co(NO3)3 + 3(NH4)2S = Co2S3 + 6NH4NO3
    CuSO4 + NH3 = Cu(NH3)4 SO4 CuSO4 + 4NH3 = Cu(NH3)4SO4
    C5H60+O2=CO2+H2O C5H60 + 20O2 = 5CO2 + 30H2O
    C9H20+O2=H2O+CO2 C9H20 + 14O2 = 10H2O + 9CO2
    CH3COOH+Na2CO3=CH3COONa+CO2+H2O 2CH3COOH + Na2CO3 = 2CH3COONa + CO2 + H2O
    CuO2(aq) + H2SO4(aq) = Cu(SO4)(aq) + H2O(l) + SO2(aq) -1CuO2(aq) + 0H2SO4(aq) = -1Cu(SO4)(aq) + 0H2O(l) + SO2(aq)
    C2H4O (g) + O2 (g) =CO2 (g) + H2O (g) 2C2H4O(g) + 5O2(g) = 4CO2(g) + 4H2O(g)
    C2H4O2+O2=CO2+H2O C2H4O2 + 2O2 = 2CO2 + 2H2O
    Cr2O3 + Si = Cr + SiO2 2Cr2O3 + 3Si = 4Cr + 3SiO2
    Ca(OH)2 + HCl = CaCl2 + H2O Ca(OH)2 + 2HCl = CaCl2 + 2H2O
    CuO2 + H2SO4 = Cu(SO4) + H2O + SO2 -1CuO2 + 0H2SO4 = -1Cu(SO4) + 0H2O + SO2
    CuO2 + 2H2SO4 = Cu(SO4) + 2H2O + SO2 -1CuO2 + 0H2SO4 = -1Cu(SO4) + 0H2O + SO2
    CH3OCH3 + HBr = CH3OHCH3 + HBr 0CH3OCH3 + HBr = 0CH3OHCH3 + HBr
    CH3OCH3 + HBr = CH3OHCH3 + Br CH3OCH3 + HBr = CH3OHCH3 + Br
    Ca(OH)2 + HNO3 = Ca(NO3)2 + H2O Ca(OH)2 + 2HNO3 = Ca(NO3)2 + 2H2O
    C2H2 + O2 = CO2 + H2O 2C2H2 + 5O2 = 4CO2 + 2H2O
    Cu + NO2- = Cu2+ + NO2 -2Cu + NO2- = -1Cu2+ + NO2
    C9H20+O2 = H2O+CO2 C9H20 + 14O2 = 10H2O + 9CO2
    C9H20+O2 = H20+CO2 C9H20 + 9O2 = H20 + 9CO2
    C2H4+HCl+O2=ClCH2CH2Cl+H2O 2C2H4 + 4HCl + O2 = 2ClCH2CH2Cl + 2H2O
    C12H22O11 + H2SO4 = CO2 + SO2 +H2O C12H22O11 + 24H2SO4 = 12CO2 + 24SO2 + 35H2O
    CH3COOH + Na2CO3 = CO2 + CH3COONa + H2O 2CH3COOH + Na2CO3 = CO2 + 2CH3COONa + H2O
    CH4+O2=CO2+H2O CH4 + 2O2 = CO2 + 2H2O
    CH3OH+O2 = CO2+H2O 2CH3OH + 3O2 = 2CO2 + 4H2O
    CH3O3+O2 = CO2+H2O 4CH3O3 + O2 = 4CO2 + 6H2O
    C4H10 + O2 = CO2 + H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
    Cu3(PO4)2+HCl = CuCl2 + H3PO4 Cu3(PO4)2 + 6HCl = 3CuCl2 + 2H3PO4
    C4H10+O2=CO2+H2O 2C4H10 + 13O2 = 8CO2 + 10H2O
    C5H12 + O2 = CO2 + H2O C5H12 + 8O2 = 5CO2 + 6H2O
    CuCl2 + K2CrO4 =2KCl + CuCrO4 CuCl2 + K2CrO4 = 2KCl + CuCrO4
    CH3NH2+O2=CO2+H2O+N2 4CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
    Cu(NO3)2+NaOH=Cu(OH)2+NaNO3 Cu(NO3)2 + 2NaOH = Cu(OH)2 + 2NaNO3
    C8H18+O2 = CO2+H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
    CuSO4+NH3=NSO4+CuH3 CuSO4 + NH3 = NSO4 + CuH3
    C4H10(g)+O2(g)=CO2(g)+H2O(g) 2C4H10(g) + 13O2(g) = 8CO2(g) + 10H2O(g)
    Cu(NO3)2+NH3=N(NO3)2+CuH3 Cu(NO3)2 + NH3 = N(NO3)2 + CuH3
    Ca(OH)2+H3PO4=Ca3(PO4)2+H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
    CH3CH3+O2=CO2+H2O 2CH3CH3 + 7O2 = 4CO2 + 6H2O
    Cl2(g)+KI(aq)=KCl(aq)+I2(s) Cl2(g) + 2KI(aq) = 2KCl(aq) + I2(s)
    CoCl2 + NH3=NCl2+CoH3 CoCl2 + NH3 = NCl2 + CoH3
    CoCl2+Na2CO3=CoCO3+NaCl CoCl2 + Na2CO3 = CoCO3 + 2NaCl
    Ca3P2+H2O=Ca(OH)2+PH3 Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
    Co2O3(s)+C(s)=Co(s)+CO2(g) 2Co2O3(s) + 3C(s) = 4Co(s) + 3CO2(g)
    C6H6 + O2 = CO + H2O 2C6H6 + 9O2 = 12CO + 6H2O
    C5H6O(l) + O2(g) = CO2(g) + H2O(l) C5H6O(l) + 6O2(g) = 5CO2(g) + 3H2O(l)
    C3H6(g) + O2(g) = CO2(g) + H2O(l) 2C3H6(g) + 9O2(g) = 6CO2(g) + 6H2O(l)
    CH3NH2(g) + O2(g)= CO2(g) + H2O(g) + N2(g) 4CH3NH2(g) + 9O2(g) = 4CO2(g) + 10H2O(g) + 2N2(g)
    Cu(NO3)2+Na2CO3=CuCO3+NaNO3 Cu(NO3)2 + Na2CO3 = CuCO3 + 2NaNO3
    CaSiO3+HF = SiF4+CaF2+H2O CaSiO3 + 6HF = SiF4 + CaF2 + 3H2O
    CuSO4+NaOH=Na2SO4+Cu(OH)2 CuSO4 + 2NaOH = Na2SO4 + Cu(OH)2
    C4H10O+HCl=C4H9Cl+H2+O C4H10O + HCl = C4H9Cl + H2 + O
    Cu(NO3)2+6KOH = 3Cu(OH)2+6KNO3 Cu(NO3)2 + 2KOH = Cu(OH)2 + 2KNO3
    CH3NH2+O2=CO2+H2O+N2 4CH3NH2 + 9O2 = 4CO2 + 10H2O + 2N2
    C2H2+O2=CO2+H2O 2C2H2 + 5O2 = 4CO2 + 2H2O
    CuSO4+NaOH=NaSO4+CuOH CuSO4 + NaOH = NaSO4 + CuOH
    CaCO3 +HCl = CO2 + CaCl2 + H2O CaCO3 + 2HCl = CO2 + CaCl2 + H2O
    Cr(OH)3 + -1IO + -1OH = -1CrO4 + -I + H2O Cr(OH)3 + 2-1IO + -1OH = -1CrO4 + 2-I + 2H2O
    Ca(OH)2+H3PO4=Ca3(PO4)2+H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
    C7H8O2+O2=CO2+H2O C7H8O2 + 8O2 = 7CO2 + 4H2O
    C5H6O+O2 = CO2+H2O C5H6O + 6O2 = 5CO2 + 3H2O
    C2H6 (g) + 5 O (g) = 2 CO (g) + 3 H2O (g) C2H6(g) + 5O(g) = 2CO(g) + 3H2O(g)
    Ca3P2+H2O=Ca(OH)2+PH3 Ca3P2 + 6H2O = 3Ca(OH)2 + 2PH3
    C2H6+Cl2=C2H5Cl+C2H4Cl2 -1C2H6 + 0Cl2 = -2C2H5Cl + C2H4Cl2
    C5H10O2+O2=CO2+H2O 2C5H10O2 + 13O2 = 10CO2 + 10H2O
    CoCl2+NaCO3=Co(CO3)2+NaCl CoCl2 + 2NaCO3 = Co(CO3)2 + 2NaCl
    Ca(NO3)2+NH4F=CaF2+N2O+H2O Ca(NO3)2 + 2NH4F = CaF2 + 2N2O + 4H2O
    Cu + H2SO4= CuSO4+SO2+H2O Cu + 2H2SO4 = CuSO4 + SO2 + 2H2O
    C3H5N3O9=3CO2 + 5H2O + 3N2 + 1O2 4C3H5N3O9 = 12CO2 + 10H2O + 6N2 + O2
    Ca(OH)2 + H3PO4 = Ca3(PO4)2 + H2O 3Ca(OH)2 + 2H3PO4 = Ca3(PO4)2 + 6H2O
    Cu + H2SO4= Cu2SO4+SO2+H2O 2Cu + 2H2SO4 = Cu2SO4 + SO2 + 2H2O
    Ca(OH)2+HCl=CaCl2+HOH Ca(OH)2 + 2HCl = CaCl2 + 2HOH
    Ca(NO3)2 + (NH4)F = CaF2 + N2O + H2O Ca(NO3)2 + 2(NH4)F = CaF2 + 2N2O + 4H2O
    Ca(OH)2=CaO+H2O Ca(OH)2 = CaO + H2O
    CaO(s) + 6C(s) = 7CaC2(s) + 8CO2(g) 2CaO(s) + 5C(s) = 2CaC2(s) + CO2(g)
    C6H12O6=H2O+C2 C6H12O6 = 6H2O + 3C2
    C12H22O11=8C3+H2O C12H22O11 = 4C3 + 11H2O
    CO2=C2+O2 2CO2 = C2 + 2O2
    C8H18 +O2 = CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
    Cl2 + NaOH = NaCl + NaClO3 + H2O 3Cl2 + 6NaOH = 5NaCl + NaClO3 + 3H2O
    C12H22O11+H2O=C6H12O6 C12H22O11 + H2O = 2C6H12O6
    Cu2CO3(OH)2 + C = Cu + CO2 + H2O Cu2CO3(OH)2 + C = 2Cu + 2CO2 + H2O
    CaSiO3+HF=SiF4+CaF2+H2O CaSiO3 + 6HF = SiF4 + CaF2 + 3H2O
    CaCO3+H2SO4=Ca+SO4+H2O+CO2 CaCO3 + H2SO4 = Ca + SO4 + H2O + CO2
    Co(OH)3 + O2 = Co2O3 + H2O 2Co(OH)3 + 0O2 = Co2O3 + 3H2O
    C3H8(g)+O2(g)=CO2(g)+H2O(l) C3H8(g) + 5O2(g) = 3CO2(g) + 4H2O(l)
    Cu(NO3)2(aq)+KOH(aq)=Cu(OH)2(s)+KNO3(aq) Cu(NO3)2(aq) + 2KOH(aq) = Cu(OH)2(s) + 2KNO3(aq)
    Cu(NO3)2+KOH=Cu(OH)2+KNO3 Cu(NO3)2 + 2KOH = Cu(OH)2 + 2KNO3
    C8H18 + O2 = CO2 + H2O 2C8H18 + 25O2 = 16CO2 + 18H2O
    Ca(OH)2+HCl=CaCl2+HOH Ca(OH)2 + 2HCl = CaCl2 + 2HOH
    C4H10 + O = CO2 + H2O C4H10 + 13O = 4CO2 + 5H2O
    C5H10O2+O2=CO2+H2O 2C5H10O2 + 13O2 = 10CO2 + 10H2O
    C4H6+O2=CO2+H2O 2C4H6 + 11O2 = 8CO2 + 6H2O
    C3H3(g)+O2(g)=CO2(g)+H2O(l) 4C3H3(g) + 15O2(g) = 12CO2(g) + 6H2O(l)
    CaO (s) + H2O (l) = Ca(OH)2 (s) CaO(s) + H2O(l) = Ca(OH)2(s)
    CH4 + Cl2=CCl4 + HCl CH4 + 4Cl2 = CCl4 + 4HCl

    Nhắn tin cho tác giả
    Nguyễn Tuyết Tuyết @ 22:50 21/09/2010
    Số lượt xem: 1049
    Số lượt thích: 0 người
    Avatar
    FDA Drug Database
    Browse Equations A B C D E F G H I J K L M N O P Q R S T U V W X Y Z 0 1 2 3 4 5 6 7 8 9 
     
    Gửi ý kiến